C26H35N3O3S2 — CID 56998001
(2S)-2-amino-3-cyclohexyl-N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]propanamide (PubChem CID 56998001) has the molecular formula C26H35N3O3S2 and a molecular weight of 501.72 g/mol. Its IUPAC name is (2S)-2-amino-3-cyclohexyl-N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]propanamide.
| Compound Name | (2S)-2-amino-3-cyclohexyl-N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 56998001 |
| Molecular Formula | C26H35N3O3S2 |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (2S)-2-amino-3-cyclohexyl-N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]propanamide |
| SMILES | N[C@@H](CC1CCCCC1)C(=O)Nc1cccc(-c2ccc([C@@]3(CC(=O)NO)CCCCS3)s2)c1 |
| InChI | InChI=1S/C26H35N3O3S2/c27-21(15-18-7-2-1-3-8-18)25(31)28-20-10-6-9-19(16-20)22-11-12-23(34-22)26(17-24(30)29-32)13-4-5-14-33-26/h6,9-12,16,18,21,32H,1-5,7-8,13-15,17,27H2,(H,28,31)(H,29,30)/t21-,26-/m0/s1 |
| InChIKey | XWSZARPOJBALBX-LVXARBLLSA-N |
| XLogP | 5.66 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|