C25H32N2O5S2 — CID 57268467
2-[(2S)-2-[5-[3-[(2-methoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 57268467) has the molecular formula C25H32N2O5S2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-[(2S)-2-[5-[3-[(2-methoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(2S)-2-[5-[3-[(2-methoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 57268467 |
| Molecular Formula | C25H32N2O5S2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 2-[(2S)-2-[5-[3-[(2-methoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | COCC(=O)Nc1cccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCCCS3)s2)c1 |
| InChI | InChI=1S/C25H32N2O5S2/c1-30-17-23(29)26-19-8-6-7-18(15-19)20-10-11-21(34-20)25(12-3-5-14-33-25)16-22(28)27-32-24-9-2-4-13-31-24/h6-8,10-11,15,24H,2-5,9,12-14,16-17H2,1H3,(H,26,29)(H,27,28)/t24?,25-/m0/s1 |
| InChIKey | YCHBYZNAWJECSQ-BBMPLOMVSA-N |
| XLogP | 5.08 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|