C28H43N3O — CID 57043489
(6R)-3-(methylamino)-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 57043489) has the molecular formula C28H43N3O and a molecular weight of 437.67 g/mol. Its IUPAC name is (6R)-3-(methylamino)-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6R)-3-(methylamino)-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 57043489 |
| Molecular Formula | C28H43N3O |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | (6R)-3-(methylamino)-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCCN(CCCCCCNCCc1ccccc1)[C@@H]1CCc2cc(O)c(NC)cc2C1 |
| InChI | InChI=1S/C28H43N3O/c1-3-18-31(26-14-13-24-22-28(32)27(29-2)21-25(24)20-26)19-10-5-4-9-16-30-17-15-23-11-7-6-8-12-23/h6-8,11-12,21-22,26,29-30,32H,3-5,9-10,13-20H2,1-2H3/t26-/m1/s1 |
| InChIKey | QHZRNYJHSZAXJU-AREMUKBSSA-N |
| XLogP | 5.40 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|