C13H8Cl4F3N3O2 — CID 57049707
3-methyl-5-(1,2,2,2-tetrachloroethylimino)-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 57049707) has the molecular formula C13H8Cl4F3N3O2 and a molecular weight of 437.03 g/mol. Its IUPAC name is 3-methyl-5-(1,2,2,2-tetrachloroethylimino)-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-methyl-5-(1,2,2,2-tetrachloroethylimino)-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57049707 |
| Molecular Formula | C13H8Cl4F3N3O2 |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 434.93 |
| IUPAC Name | 3-methyl-5-(1,2,2,2-tetrachloroethylimino)-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=NC(Cl)C(Cl)(Cl)Cl)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C13H8Cl4F3N3O2/c1-22-9(24)8(21-10(14)12(15,16)17)23(11(22)25)7-4-2-3-6(5-7)13(18,19)20/h2-5,10H,1H3 |
| InChIKey | YXGBBAJBAHJTKZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|