C23H37NO7S — CID 57064552
3-amino-2-[3,4-bis(2,2-dimethylpentanoyloxy)phenyl]propane-1-sulfonic acid (PubChem CID 57064552) has the molecular formula C23H37NO7S and a molecular weight of 471.62 g/mol. Its IUPAC name is 3-amino-2-[3,4-bis(2,2-dimethylpentanoyloxy)phenyl]propane-1-sulfonic acid.
| Compound Name | 3-amino-2-[3,4-bis(2,2-dimethylpentanoyloxy)phenyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 57064552 |
| Molecular Formula | C23H37NO7S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 3-amino-2-[3,4-bis(2,2-dimethylpentanoyloxy)phenyl]propane-1-sulfonic acid |
| SMILES | CCCC(C)(C)C(=O)Oc1ccc(C(CN)CS(=O)(=O)O)cc1OC(=O)C(C)(C)CCC |
| InChI | InChI=1S/C23H37NO7S/c1-7-11-22(3,4)20(25)30-18-10-9-16(17(14-24)15-32(27,28)29)13-19(18)31-21(26)23(5,6)12-8-2/h9-10,13,17H,7-8,11-12,14-15,24H2,1-6H3,(H,27,28,29) |
| InChIKey | TYSQJJGSANWPLJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|