C23H39NO8S — CID 88753449
[4-(2-amino-1-hydroxyethyl)-2-(2,2-dimethylpentanoyloxy)phenyl] 2,2-dimethylpentanoate;methanesulfonic acid (PubChem CID 88753449) has the molecular formula C23H39NO8S and a molecular weight of 489.63 g/mol. Its IUPAC name is [4-(2-amino-1-hydroxyethyl)-2-(2,2-dimethylpentanoyloxy)phenyl] 2,2-dimethylpentanoate;methanesulfonic acid.
| Compound Name | [4-(2-amino-1-hydroxyethyl)-2-(2,2-dimethylpentanoyloxy)phenyl] 2,2-dimethylpentanoate;methanesulfonic acid |
|---|---|
| PubChem CID | 88753449 |
| Molecular Formula | C23H39NO8S |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | [4-(2-amino-1-hydroxyethyl)-2-(2,2-dimethylpentanoyloxy)phenyl] 2,2-dimethylpentanoate;methanesulfonic acid |
| SMILES | CCCC(C)(C)C(=O)Oc1ccc(C(O)CN)cc1OC(=O)C(C)(C)CCC.CS(=O)(=O)O |
| InChI | InChI=1S/C22H35NO5.CH4O3S/c1-7-11-21(3,4)19(25)27-17-10-9-15(16(24)14-23)13-18(17)28-20(26)22(5,6)12-8-2;1-5(2,3)4/h9-10,13,16,24H,7-8,11-12,14,23H2,1-6H3;1H3,(H,2,3,4) |
| InChIKey | FBMHNUYHMVOJRO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|