C23H40O2Si — CID 57108542
(7R)-7-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyloct-4-yn-3-ol (PubChem CID 57108542) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (7R)-7-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyloct-4-yn-3-ol.
| Compound Name | (7R)-7-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyloct-4-yn-3-ol |
|---|---|
| PubChem CID | 57108542 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (7R)-7-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3-ethyloct-4-yn-3-ol |
| SMILES | CCC(O)(C#CC[C@@H](C)C1=CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C)CC |
| InChI | InChI=1S/C23H40O2Si/c1-8-23(24,9-2)17-10-12-18(3)19-14-15-20-21(25-26(5,6)7)13-11-16-22(19,20)4/h14,18,20-21,24H,8-9,11-13,15-16H2,1-7H3/t18-,20+,21+,22-/m1/s1 |
| InChIKey | DHZYATWVMVPEBP-RYFAJOAYSA-N |
| XLogP | 5.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|