C34H47N3OS — CID 57141920
(4R,5R)-2-benzyl-3,3-dibutyl-7-(dimethylamino)-5-[3-(ethylamino)phenyl]-4,5-dihydro-1,2-benzothiazepin-4-ol (PubChem CID 57141920) has the molecular formula C34H47N3OS and a molecular weight of 545.84 g/mol. Its IUPAC name is (4R,5R)-2-benzyl-3,3-dibutyl-7-(dimethylamino)-5-[3-(ethylamino)phenyl]-4,5-dihydro-1,2-benzothiazepin-4-ol.
| Compound Name | (4R,5R)-2-benzyl-3,3-dibutyl-7-(dimethylamino)-5-[3-(ethylamino)phenyl]-4,5-dihydro-1,2-benzothiazepin-4-ol |
|---|---|
| PubChem CID | 57141920 |
| Molecular Formula | C34H47N3OS |
| Molecular Weight | 545.84 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | (4R,5R)-2-benzyl-3,3-dibutyl-7-(dimethylamino)-5-[3-(ethylamino)phenyl]-4,5-dihydro-1,2-benzothiazepin-4-ol |
| SMILES | CCCCC1(CCCC)[C@H](O)[C@H](c2cccc(NCC)c2)c2cc(N(C)C)ccc2SN1Cc1ccccc1 |
| InChI | InChI=1S/C34H47N3OS/c1-6-9-21-34(22-10-7-2)33(38)32(27-17-14-18-28(23-27)35-8-3)30-24-29(36(4)5)19-20-31(30)39-37(34)25-26-15-12-11-13-16-26/h11-20,23-24,32-33,35,38H,6-10,21-22,25H2,1-5H3/t32-,33-/m1/s1 |
| InChIKey | LIDQNAQDWYNNNH-CZNDPXEESA-N |
| XLogP | 8.32 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.84 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|