C19H28N2O2 — CID 57169028
(2R)-1-[(6-benzylidene-2-methylcyclohexen-1-yl)amino]oxy-3-(dimethylamino)propan-2-ol (PubChem CID 57169028) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2R)-1-[(6-benzylidene-2-methylcyclohexen-1-yl)amino]oxy-3-(dimethylamino)propan-2-ol.
| Compound Name | (2R)-1-[(6-benzylidene-2-methylcyclohexen-1-yl)amino]oxy-3-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 57169028 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2R)-1-[(6-benzylidene-2-methylcyclohexen-1-yl)amino]oxy-3-(dimethylamino)propan-2-ol |
| SMILES | CC1=C(NOC[C@H](O)CN(C)C)C(=Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C19H28N2O2/c1-15-8-7-11-17(12-16-9-5-4-6-10-16)19(15)20-23-14-18(22)13-21(2)3/h4-6,9-10,12,18,20,22H,7-8,11,13-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | AGEJZMOLUKQVKA-GOSISDBHSA-N |
| XLogP | 2.97 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|