C66H128N6 — CID 57198690
2,2,6,6-tetramethyl-4-[1,1,1,2,2-pentakis(2,2,6,6-tetramethylpiperidin-4-yl)dodecan-3-yl]piperidine (PubChem CID 57198690) has the molecular formula C66H128N6 and a molecular weight of 1005.79 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[1,1,1,2,2-pentakis(2,2,6,6-tetramethylpiperidin-4-yl)dodecan-3-yl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[1,1,1,2,2-pentakis(2,2,6,6-tetramethylpiperidin-4-yl)dodecan-3-yl]piperidine |
|---|---|
| PubChem CID | 57198690 |
| Molecular Formula | C66H128N6 |
| Molecular Weight | 1005.79 g/mol |
| Exact Mass | 1005.02 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[1,1,1,2,2-pentakis(2,2,6,6-tetramethylpiperidin-4-yl)dodecan-3-yl]piperidine |
| SMILES | CCCCCCCCCC(C1CC(C)(C)NC(C)(C)C1)C(C1CC(C)(C)NC(C)(C)C1)(C1CC(C)(C)NC(C)(C)C1)C(C1CC(C)(C)NC(C)(C)C1)(C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C66H128N6/c1-26-27-28-29-30-31-32-33-52(46-34-53(2,3)67-54(4,5)35-46)66(50-42-61(18,19)71-62(20,21)43-50,51-44-63(22,23)72-64(24,25)45-51)65(47-36-55(6,7)68-56(8,9)37-47,48-38-57(10,11)69-58(12,13)39-48)49-40-59(14,15)70-60(16,17)41-49/h46-52,67-72H,26-45H2,1-25H3 |
| InChIKey | SNAGVNKPEQKONI-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.79 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|