C19H30N2O3 — CID 57246056
3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanamide (PubChem CID 57246056) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanamide.
| Compound Name | 3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanamide |
|---|---|
| PubChem CID | 57246056 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanamide |
| SMILES | CCCCCC(O)C=CC1=CC[C@@H]2CC(NOCCC(N)=O)=C[C@@H]12 |
| InChI | InChI=1S/C19H30N2O3/c1-2-3-4-5-17(22)9-8-14-6-7-15-12-16(13-18(14)15)21-24-11-10-19(20)23/h6,8-9,13,15,17-18,21-22H,2-5,7,10-12H2,1H3,(H2,20,23)/t15-,17?,18+/m1/s1 |
| InChIKey | HXEZVCCJRSPCCJ-IKJNGHJTSA-N |
| XLogP | 2.73 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|