C20H31NO4 — CID 57269093
methyl 3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanoate (PubChem CID 57269093) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is methyl 3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanoate.
| Compound Name | methyl 3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanoate |
|---|---|
| PubChem CID | 57269093 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | methyl 3-[[(3aS,6aR)-4-(3-hydroxyoct-1-enyl)-1,3a,6,6a-tetrahydropentalen-2-yl]amino]oxypropanoate |
| SMILES | CCCCCC(O)C=CC1=CC[C@@H]2CC(NOCCC(=O)OC)=C[C@@H]12 |
| InChI | InChI=1S/C20H31NO4/c1-3-4-5-6-18(22)10-9-15-7-8-16-13-17(14-19(15)16)21-25-12-11-20(23)24-2/h7,9-10,14,16,18-19,21-22H,3-6,8,11-13H2,1-2H3/t16-,18?,19+/m1/s1 |
| InChIKey | GFPJNCXCMJHVIY-WDOSNPKHSA-N |
| XLogP | 3.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|