C26H39NO2S — CID 57252543
3-[[(3S,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadecan-17-yl]sulfanyl]propan-1-amine (PubChem CID 57252543) has the molecular formula C26H39NO2S and a molecular weight of 429.67 g/mol. Its IUPAC name is 3-[[(3S,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadecan-17-yl]sulfanyl]propan-1-amine.
| Compound Name | 3-[[(3S,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadecan-17-yl]sulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 57252543 |
| Molecular Formula | C26H39NO2S |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 3-[[(3S,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadecan-17-yl]sulfanyl]propan-1-amine |
| SMILES | C[C@@]12CC3OC4CC(c5ccoc5)[C@@]5(C)CC[C@@H]1[C@@H](CCC2CC3SCCCN)[C@H]45 |
| InChI | InChI=1S/C26H39NO2S/c1-25-8-6-19-18-5-4-17-12-23(30-11-3-9-27)22(14-26(17,19)2)29-21(24(18)25)13-20(25)16-7-10-28-15-16/h7,10,15,17-24H,3-6,8-9,11-14,27H2,1-2H3/t17?,18-,19-,20?,21?,22?,23?,24-,25-,26+/m1/s1 |
| InChIKey | MNJDLRWTGGREQX-LMKLNRPTSA-N |
| XLogP | 5.84 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|