C22H31NO6 — CID 57264392
3,7-dimethylocta-2,6-dienyl (1R,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate (PubChem CID 57264392) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl (1R,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl (1R,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
|---|---|
| PubChem CID | 57264392 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl (1R,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
| SMILES | CNC(=O)O[C@@H]1OC=C(C(=O)OCC=C(C)CCC=C(C)C)[C@H]2C[C@@H]3O[C@]3(C)[C@H]12 |
| InChI | InChI=1S/C22H31NO6/c1-13(2)7-6-8-14(3)9-10-26-19(24)16-12-27-20(28-21(25)23-5)18-15(16)11-17-22(18,4)29-17/h7,9,12,15,17-18,20H,6,8,10-11H2,1-5H3,(H,23,25)/t15-,17+,18+,20+,22+/m1/s1 |
| InChIKey | FQWOFISWTHJCRN-ATWAJCGKSA-N |
| XLogP | 3.61 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|