C23H22ClF3N2O8S — CID 57268585
ethyl 2-[2-[[1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethenyl]amino]oxyacetyl]sulfanylpropanoate (PubChem CID 57268585) has the molecular formula C23H22ClF3N2O8S and a molecular weight of 578.95 g/mol. Its IUPAC name is ethyl 2-[2-[[1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethenyl]amino]oxyacetyl]sulfanylpropanoate.
| Compound Name | ethyl 2-[2-[[1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethenyl]amino]oxyacetyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 57268585 |
| Molecular Formula | C23H22ClF3N2O8S |
| Molecular Weight | 578.95 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | ethyl 2-[2-[[1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethenyl]amino]oxyacetyl]sulfanylpropanoate |
| SMILES | CCOC(=O)C(C)SC(=O)CONC(=COC)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22ClF3N2O8S/c1-4-35-22(31)13(2)38-21(30)12-36-28-18(11-34-3)16-10-15(6-7-19(16)29(32)33)37-20-8-5-14(9-17(20)24)23(25,26)27/h5-11,13,28H,4,12H2,1-3H3 |
| InChIKey | DBMIXQXGBIPWNA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|