C11H14N2O3S — CID 57276914
1-(1,3-benzodioxol-5-ylmethyl)-1-(2-sulfanylethyl)urea (PubChem CID 57276914) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-(2-sulfanylethyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-(2-sulfanylethyl)urea |
|---|---|
| PubChem CID | 57276914 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-(2-sulfanylethyl)urea |
| SMILES | NC(=O)N(CCS)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14N2O3S/c12-11(14)13(3-4-17)6-8-1-2-9-10(5-8)16-7-15-9/h1-2,5,17H,3-4,6-7H2,(H2,12,14) |
| InChIKey | JYFPEQNHGJPOBM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|