C7H8Cl2O8P2S — CID 57296481
[[benzenesulfonyloxy(hydroxy)phosphoryl]-dichloromethyl]phosphonic acid (PubChem CID 57296481) has the molecular formula C7H8Cl2O8P2S and a molecular weight of 385.05 g/mol. Its IUPAC name is [[benzenesulfonyloxy(hydroxy)phosphoryl]-dichloromethyl]phosphonic acid.
| Compound Name | [[benzenesulfonyloxy(hydroxy)phosphoryl]-dichloromethyl]phosphonic acid |
|---|---|
| PubChem CID | 57296481 |
| Molecular Formula | C7H8Cl2O8P2S |
| Molecular Weight | 385.05 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | [[benzenesulfonyloxy(hydroxy)phosphoryl]-dichloromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Cl)(Cl)P(=O)(O)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8Cl2O8P2S/c8-7(9,18(10,11)12)19(13,14)17-20(15,16)6-4-2-1-3-5-6/h1-5H,(H,13,14)(H2,10,11,12) |
| InChIKey | WIBRHEKGYDCHRO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.05 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|