C20H33O4S- — CID 58019197
(2E,6E,10E,14E)-1,16-dihydroxy-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate (PubChem CID 58019197) has the molecular formula C20H33O4S- and a molecular weight of 369.55 g/mol. Its IUPAC name is (2E,6E,10E,14E)-1,16-dihydroxy-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate.
| Compound Name | (2E,6E,10E,14E)-1,16-dihydroxy-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate |
|---|---|
| PubChem CID | 58019197 |
| Molecular Formula | C20H33O4S- |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (2E,6E,10E,14E)-1,16-dihydroxy-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfinate |
| SMILES | C/C(=C\CC/C(C)=C/CC(/C=C(\C)CC/C=C(\C)CO)S(=O)[O-])CO |
| InChI | InChI=1S/C20H34O4S/c1-16(7-5-9-18(3)14-21)11-12-20(25(23)24)13-17(2)8-6-10-19(4)15-22/h9-11,13,20-22H,5-8,12,14-15H2,1-4H3,(H,23,24)/p-1/b16-11+,17-13+,18-9+,19-10+ |
| InChIKey | MHANXUZQLNUTFM-JORMXOPISA-M |
| XLogP | 3.95 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|