C16H14F3N3O3S — CID 58119173
2-amino-4-methylsulfanyl-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]propoxy]pyrimidine-5-carbaldehyde (PubChem CID 58119173) has the molecular formula C16H14F3N3O3S and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-amino-4-methylsulfanyl-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]propoxy]pyrimidine-5-carbaldehyde.
| Compound Name | 2-amino-4-methylsulfanyl-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]propoxy]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 58119173 |
| Molecular Formula | C16H14F3N3O3S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-amino-4-methylsulfanyl-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]propoxy]pyrimidine-5-carbaldehyde |
| SMILES | CSc1nc(N)nc(OCC(=O)Cc2cccc(C(F)(F)F)c2)c1C=O |
| InChI | InChI=1S/C16H14F3N3O3S/c1-26-14-12(7-23)13(21-15(20)22-14)25-8-11(24)6-9-3-2-4-10(5-9)16(17,18)19/h2-5,7H,6,8H2,1H3,(H2,20,21,22) |
| InChIKey | SJIUZBJOTTWVGG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|