C24H29N2O3+ — CID 58130896
[1-ethyl-2-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]-5-hydroxy-3,3-dimethylindol-1-ium-4-yl] formate (PubChem CID 58130896) has the molecular formula C24H29N2O3+ and a molecular weight of 393.51 g/mol. Its IUPAC name is [1-ethyl-2-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]-5-hydroxy-3,3-dimethylindol-1-ium-4-yl] formate.
| Compound Name | [1-ethyl-2-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]-5-hydroxy-3,3-dimethylindol-1-ium-4-yl] formate |
|---|---|
| PubChem CID | 58130896 |
| Molecular Formula | C24H29N2O3+ |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [1-ethyl-2-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]-5-hydroxy-3,3-dimethylindol-1-ium-4-yl] formate |
| SMILES | CCN(C)c1ccc(/C=C/C2=[N+](CC)c3ccc(O)c(OC=O)c3C2(C)C)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-6-25(5)18-11-8-17(9-12-18)10-15-21-24(3,4)22-19(26(21)7-2)13-14-20(28)23(22)29-16-27/h8-16H,6-7H2,1-5H3/p+1 |
| InChIKey | QRDIIRDGNCAKPK-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|