About [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone
[5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone (PubChem CID 58159043) has the molecular formula C11H8BrNO2
and a molecular weight of 266.09 g/mol. Its IUPAC name is [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone |
| PubChem CID | 58159043 |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ncc(CBr)o1 |
| InChI | InChI=1S/C11H8BrNO2/c12-6-9-7-13-11(15-9)10(14)8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | WNUAJZJHYMGKPY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone?
The IUPAC name of [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone (CID 58159043) is [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone.
What is the SMILES notation for [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone?
The canonical SMILES for [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone is O=C(c1ccccc1)c1ncc(CBr)o1.
What is the InChIKey of [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone?
The InChIKey is WNUAJZJHYMGKPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO2/c12-6-9-7-13-11(15-9)10(14)8-4-2-1-3-5-8/h1-5,7H,6H2.
What are the key properties of [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone?
[5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone has a molecular weight of 266.09 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(bromomethyl)-1,3-oxazol-2-yl]-phenylmethanone is sourced from PubChem (CID 58159043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).