C21H21F2IN2O3S — CID 58196949
2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzonitrile (PubChem CID 58196949) has the molecular formula C21H21F2IN2O3S and a molecular weight of 546.38 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzonitrile.
| Compound Name | 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzonitrile |
|---|---|
| PubChem CID | 58196949 |
| Molecular Formula | C21H21F2IN2O3S |
| Molecular Weight | 546.38 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzonitrile |
| SMILES | N#Cc1c(Cc2ccc(I)cc2F)cc(F)cc1OCCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C21H21F2IN2O3S/c22-17-11-16(10-15-2-3-18(24)13-20(15)23)19(14-25)21(12-17)29-7-1-4-26-5-8-30(27,28)9-6-26/h2-3,11-13H,1,4-10H2 |
| InChIKey | XDRIVARWQAZNFQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|