C10H13N — CID 58220554
N,3,5-trimethyl-4-methylidenecyclohexa-2,5-dien-1-imine (PubChem CID 58220554) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is N,3,5-trimethyl-4-methylidenecyclohexa-2,5-dien-1-imine.
| Compound Name | N,3,5-trimethyl-4-methylidenecyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 58220554 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N,3,5-trimethyl-4-methylidenecyclohexa-2,5-dien-1-imine |
| SMILES | C=C1C(C)=CC(=NC)C=C1C |
| InChI | InChI=1S/C10H13N/c1-7-5-10(11-4)6-8(2)9(7)3/h5-6H,3H2,1-2,4H3 |
| InChIKey | MMCQPJONBNIIPX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|