C30H43N3O5Si — CID 58382386
tert-butyl 2-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]acetate (PubChem CID 58382386) has the molecular formula C30H43N3O5Si and a molecular weight of 553.78 g/mol. Its IUPAC name is tert-butyl 2-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]acetate.
| Compound Name | tert-butyl 2-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]acetate |
|---|---|
| PubChem CID | 58382386 |
| Molecular Formula | C30H43N3O5Si |
| Molecular Weight | 553.78 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | tert-butyl 2-[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]acetate |
| SMILES | CCc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc(CC(=O)OC(C)(C)C)nc12 |
| InChI | InChI=1S/C30H43N3O5Si/c1-9-24-26-28(31-19-23(32-26)18-25(34)38-29(2,3)4)33(20-35-16-17-39(6,7)8)27(24)21-10-12-22(13-11-21)30(5)36-14-15-37-30/h10-13,19H,9,14-18,20H2,1-8H3 |
| InChIKey | XXPJMDUOLPMIDG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.78 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|