C23H30BrN3O3Si — CID 58382168
2-[[2-bromo-7-methyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58382168) has the molecular formula C23H30BrN3O3Si and a molecular weight of 504.50 g/mol. Its IUPAC name is 2-[[2-bromo-7-methyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-bromo-7-methyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58382168 |
| Molecular Formula | C23H30BrN3O3Si |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 2-[[2-bromo-7-methyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc(Br)nc12 |
| InChI | InChI=1S/C23H30BrN3O3Si/c1-16-20-22(25-14-19(24)26-20)27(15-28-12-13-31(3,4)5)21(16)17-6-8-18(9-7-17)23(2)29-10-11-30-23/h6-9,14H,10-13,15H2,1-5H3 |
| InChIKey | YQOCTCJBCZTUNH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|