C27H37N4O3Si+ — CID 58381997
2-[[3-ethyl-12-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5,7,11-triaza-1-azoniatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58381997) has the molecular formula C27H37N4O3Si+ and a molecular weight of 493.70 g/mol. Its IUPAC name is 2-[[3-ethyl-12-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5,7,11-triaza-1-azoniatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-ethyl-12-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5,7,11-triaza-1-azoniatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58381997 |
| Molecular Formula | C27H37N4O3Si+ |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2-[[3-ethyl-12-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5,7,11-triaza-1-azoniatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc3[n+](c12)C(C)N=C3 |
| InChI | InChI=1S/C27H37N4O3Si/c1-7-23-24(20-8-10-21(11-9-20)27(3)33-12-13-34-27)30(18-32-14-15-35(4,5)6)26-25(23)31-19(2)28-16-22(31)17-29-26/h8-11,16-17,19H,7,12-15,18H2,1-6H3/q+1 |
| InChIKey | PDAMYFUGFRQCCW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|