C22H27BrIN3O3Si — CID 58382134
2-[[2-bromo-7-iodo-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58382134) has the molecular formula C22H27BrIN3O3Si and a molecular weight of 616.37 g/mol. Its IUPAC name is 2-[[2-bromo-7-iodo-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-bromo-7-iodo-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58382134 |
| Molecular Formula | C22H27BrIN3O3Si |
| Molecular Weight | 616.37 g/mol |
| Exact Mass | 615.00 |
| IUPAC Name | 2-[[2-bromo-7-iodo-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(c2ccc(-c3c(I)c4nc(Br)cnc4n3COCC[Si](C)(C)C)cc2)OCCO1 |
| InChI | InChI=1S/C22H27BrIN3O3Si/c1-22(29-9-10-30-22)16-7-5-15(6-8-16)20-18(24)19-21(25-13-17(23)26-19)27(20)14-28-11-12-31(2,3)4/h5-8,13H,9-12,14H2,1-4H3 |
| InChIKey | GPTVESYKJGJVJV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|