C67H72N2O8 — CID 58403161
9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]fluorene-2,7-diamine (PubChem CID 58403161) has the molecular formula C67H72N2O8 and a molecular weight of 1033.32 g/mol. Its IUPAC name is 9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]fluorene-2,7-diamine.
| Compound Name | 9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]fluorene-2,7-diamine |
|---|---|
| PubChem CID | 58403161 |
| Molecular Formula | C67H72N2O8 |
| Molecular Weight | 1033.32 g/mol |
| Exact Mass | 1032.53 |
| IUPAC Name | 9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]fluorene-2,7-diamine |
| SMILES | C=C(C)C(=C)OCCOc1ccc(N(c2ccc(OCCOC(=C)C(=C)C)cc2)c2ccc3c(c2)C(C)(C)c2cc(N(c4ccc(OCCOC(=C)C(=C)C)cc4)c4ccc(OCCOC(=C)C(=C)C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C67H72N2O8/c1-45(2)49(9)70-35-39-74-59-25-15-53(16-26-59)68(54-17-27-60(28-18-54)75-40-36-71-50(10)46(3)4)57-23-33-63-64-34-24-58(44-66(64)67(13,14)65(63)43-57)69(55-19-29-61(30-20-55)76-41-37-72-51(11)47(5)6)56-21-31-62(32-22-56)77-42-38-73-52(12)48(7)8/h15-34,43-44H,1,3,5,7,9-12,35-42H2,2,4,6,8,13-14H3 |
| InChIKey | JQWKVBBTBCHYDP-UHFFFAOYSA-N |
| XLogP | 16.87 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.32 |
| LogP ≤ 5 | 16.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|