C14H19NO8-4 — CID 58454944
3-[[[3-carboxylato-2-(carboxylatomethyl)propyl]-ethylamino]methyl]pentanedioate (PubChem CID 58454944) has the molecular formula C14H19NO8-4 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-[[[3-carboxylato-2-(carboxylatomethyl)propyl]-ethylamino]methyl]pentanedioate.
| Compound Name | 3-[[[3-carboxylato-2-(carboxylatomethyl)propyl]-ethylamino]methyl]pentanedioate |
|---|---|
| PubChem CID | 58454944 |
| Molecular Formula | C14H19NO8-4 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-[[[3-carboxylato-2-(carboxylatomethyl)propyl]-ethylamino]methyl]pentanedioate |
| SMILES | CCN(CC(CC(=O)[O-])CC(=O)[O-])CC(CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C14H23NO8/c1-2-15(7-9(3-11(16)17)4-12(18)19)8-10(5-13(20)21)6-14(22)23/h9-10H,2-8H2,1H3,(H,16,17)(H,18,19)(H,20,21)(H,22,23)/p-4 |
| InChIKey | JYSQNIAZRDTFMX-UHFFFAOYSA-J |
| XLogP | -4.90 |
| TPSA | 163.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |