C41H45N3O9 — CID 58481914
[6-[[5-[4-(3,5-dioxohexyl)anilino]-5-oxopentanoyl]amino]-1-(9H-fluoren-9-yl)hexyl] (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 58481914) has the molecular formula C41H45N3O9 and a molecular weight of 723.82 g/mol. Its IUPAC name is [6-[[5-[4-(3,5-dioxohexyl)anilino]-5-oxopentanoyl]amino]-1-(9H-fluoren-9-yl)hexyl] (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [6-[[5-[4-(3,5-dioxohexyl)anilino]-5-oxopentanoyl]amino]-1-(9H-fluoren-9-yl)hexyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 58481914 |
| Molecular Formula | C41H45N3O9 |
| Molecular Weight | 723.82 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | [6-[[5-[4-(3,5-dioxohexyl)anilino]-5-oxopentanoyl]amino]-1-(9H-fluoren-9-yl)hexyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CC(=O)CC(=O)CCc1ccc(NC(=O)CCCC(=O)NCCCCCC(OC(=O)ON2C(=O)CCC2=O)C2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C41H45N3O9/c1-27(45)26-30(46)22-19-28-17-20-29(21-18-28)43-37(48)16-9-15-36(47)42-25-8-2-3-14-35(52-41(51)53-44-38(49)23-24-39(44)50)40-33-12-6-4-10-31(33)32-11-5-7-13-34(32)40/h4-7,10-13,17-18,20-21,35,40H,2-3,8-9,14-16,19,22-26H2,1H3,(H,42,47)(H,43,48) |
| InChIKey | HWYXYDVBJLEAJZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.82 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|