C74H94N3O2S2+ — CID 58500594
2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-9,9-dioctylcarbazol-9-ium (PubChem CID 58500594) has the molecular formula C74H94N3O2S2+ and a molecular weight of 1121.72 g/mol. Its IUPAC name is 2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-9,9-dioctylcarbazol-9-ium.
| Compound Name | 2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-9,9-dioctylcarbazol-9-ium |
|---|---|
| PubChem CID | 58500594 |
| Molecular Formula | C74H94N3O2S2+ |
| Molecular Weight | 1121.72 g/mol |
| Exact Mass | 1120.68 |
| IUPAC Name | 2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-9,9-dioctylcarbazol-9-ium |
| SMILES | CCCCCCCCOc1cccc(-c2nc3c(-c4ccc(C)s4)ccc(-c4ccc(-c5ccc6c(c5)[N+](CCCCCCCC)(CCCCCCCC)c5cc(C)ccc5-6)s4)c3nc2-c2cccc(OCCCCCCCC)c2)c1 |
| InChI | InChI=1S/C74H94N3O2S2/c1-7-11-15-19-23-27-47-77(48-28-24-20-16-12-8-2)66-51-55(5)37-40-62(66)63-41-39-57(54-67(63)77)68-45-46-70(81-68)65-43-42-64(69-44-38-56(6)80-69)73-74(65)76-72(59-34-32-36-61(53-59)79-50-30-26-22-18-14-10-4)71(75-73)58-33-31-35-60(52-58)78-49-29-25-21-17-13-9-3/h31-46,51-54H,7-30,47-50H2,1-6H3/q+1 |
| InChIKey | BISGFXKYMUVADQ-UHFFFAOYSA-N |
| XLogP | 23.52 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.72 |
| LogP ≤ 5 | 23.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|