C40H40F2N2O2S2 — CID 154704262
6,7-difluoro-2,3-bis(3-hexoxyphenyl)-5,8-dithiophen-2-ylquinoxaline (PubChem CID 154704262) has the molecular formula C40H40F2N2O2S2 and a molecular weight of 682.90 g/mol. Its IUPAC name is 6,7-difluoro-2,3-bis(3-hexoxyphenyl)-5,8-dithiophen-2-ylquinoxaline.
| Compound Name | 6,7-difluoro-2,3-bis(3-hexoxyphenyl)-5,8-dithiophen-2-ylquinoxaline |
|---|---|
| PubChem CID | 154704262 |
| Molecular Formula | C40H40F2N2O2S2 |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | 6,7-difluoro-2,3-bis(3-hexoxyphenyl)-5,8-dithiophen-2-ylquinoxaline |
| SMILES | CCCCCCOc1cccc(-c2nc3c(-c4cccs4)c(F)c(F)c(-c4cccs4)c3nc2-c2cccc(OCCCCCC)c2)c1 |
| InChI | InChI=1S/C40H40F2N2O2S2/c1-3-5-7-9-21-45-29-17-11-15-27(25-29)37-38(28-16-12-18-30(26-28)46-22-10-8-6-4-2)44-40-34(32-20-14-24-48-32)36(42)35(41)33(39(40)43-37)31-19-13-23-47-31/h11-20,23-26H,3-10,21-22H2,1-2H3 |
| InChIKey | ZCRFPEOUYWPDMV-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|