C12H6FN3 — CID 58517633
5-fluoro-7-isocyanoimidazo[2,1-a]isoquinoline (PubChem CID 58517633) has the molecular formula C12H6FN3 and a molecular weight of 211.20 g/mol. Its IUPAC name is 5-fluoro-7-isocyanoimidazo[2,1-a]isoquinoline.
| Compound Name | 5-fluoro-7-isocyanoimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 58517633 |
| Molecular Formula | C12H6FN3 |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 5-fluoro-7-isocyanoimidazo[2,1-a]isoquinoline |
| SMILES | [C-]#[N+]c1cccc2c1cc(F)n1ccnc21 |
| InChI | InChI=1S/C12H6FN3/c1-14-10-4-2-3-8-9(10)7-11(13)16-6-5-15-12(8)16/h2-7H |
| InChIKey | BNNZYFXMQPBBKY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|