C18H16Cl2F3N3O — CID 58533522
[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]hydrazine (PubChem CID 58533522) has the molecular formula C18H16Cl2F3N3O and a molecular weight of 418.25 g/mol. Its IUPAC name is [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]hydrazine.
| Compound Name | [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]hydrazine |
|---|---|
| PubChem CID | 58533522 |
| Molecular Formula | C18H16Cl2F3N3O |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]hydrazine |
| SMILES | CCc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1NN |
| InChI | InChI=1S/C18H16Cl2F3N3O/c1-2-10-3-4-11(5-15(10)25-24)16-9-17(27-26-16,18(21,22)23)12-6-13(19)8-14(20)7-12/h3-8,25H,2,9,24H2,1H3 |
| InChIKey | VXEVYCQNTOSTQT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|