C17H24N2O2 — CID 58575699
(3,4-dimethyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indol-7-yl) 3-methylbutanoate (PubChem CID 58575699) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (3,4-dimethyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indol-7-yl) 3-methylbutanoate.
| Compound Name | (3,4-dimethyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indol-7-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 58575699 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (3,4-dimethyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indol-7-yl) 3-methylbutanoate |
| SMILES | CC(C)CC(=O)Oc1ccc2c(c1)C1CCN(C)C1N2C |
| InChI | InChI=1S/C17H24N2O2/c1-11(2)9-16(20)21-12-5-6-15-14(10-12)13-7-8-18(3)17(13)19(15)4/h5-6,10-11,13,17H,7-9H2,1-4H3 |
| InChIKey | QVKZVJQPCOTMGO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|