C38H58 — CID 58582292
9,10-bis(3,7-dimethyloctyl)-2-methyl-7-prop-1-enyl-9,10-dihydrophenanthrene (PubChem CID 58582292) has the molecular formula C38H58 and a molecular weight of 514.88 g/mol. Its IUPAC name is 9,10-bis(3,7-dimethyloctyl)-2-methyl-7-prop-1-enyl-9,10-dihydrophenanthrene.
| Compound Name | 9,10-bis(3,7-dimethyloctyl)-2-methyl-7-prop-1-enyl-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 58582292 |
| Molecular Formula | C38H58 |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 514.45 |
| IUPAC Name | 9,10-bis(3,7-dimethyloctyl)-2-methyl-7-prop-1-enyl-9,10-dihydrophenanthrene |
| SMILES | CC=Cc1ccc2c(c1)C(CCC(C)CCCC(C)C)C(CCC(C)CCCC(C)C)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C38H58/c1-9-12-32-20-24-36-34-23-19-31(8)25-37(34)33(21-17-29(6)15-10-13-27(2)3)35(38(36)26-32)22-18-30(7)16-11-14-28(4)5/h9,12,19-20,23-30,33,35H,10-11,13-18,21-22H2,1-8H3 |
| InChIKey | KSQRVASOTQGJHO-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |