C25H25BrN4O4 — CID 58583380
[(1S,2R)-1-[(5-bromo-3,6-diethylpyrazin-2-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl] 4-nitrobenzoate (PubChem CID 58583380) has the molecular formula C25H25BrN4O4 and a molecular weight of 525.40 g/mol. Its IUPAC name is [(1S,2R)-1-[(5-bromo-3,6-diethylpyrazin-2-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl] 4-nitrobenzoate.
| Compound Name | [(1S,2R)-1-[(5-bromo-3,6-diethylpyrazin-2-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 58583380 |
| Molecular Formula | C25H25BrN4O4 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | [(1S,2R)-1-[(5-bromo-3,6-diethylpyrazin-2-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl] 4-nitrobenzoate |
| SMILES | CCc1nc(N[C@H]2c3ccccc3CC[C@H]2OC(=O)c2ccc([N+](=O)[O-])cc2)c(CC)nc1Br |
| InChI | InChI=1S/C25H25BrN4O4/c1-3-19-23(26)27-20(4-2)24(28-19)29-22-18-8-6-5-7-15(18)11-14-21(22)34-25(31)16-9-12-17(13-10-16)30(32)33/h5-10,12-13,21-22H,3-4,11,14H2,1-2H3,(H,28,29)/t21-,22+/m1/s1 |
| InChIKey | YHXYSHXOBPZGPV-YADHBBJMSA-N |
| XLogP | 5.60 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|