C15H13N2O5P — CID 58600611
(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)phosphonic acid (PubChem CID 58600611) has the molecular formula C15H13N2O5P and a molecular weight of 332.25 g/mol. Its IUPAC name is (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)phosphonic acid.
| Compound Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)phosphonic acid |
|---|---|
| PubChem CID | 58600611 |
| Molecular Formula | C15H13N2O5P |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)phosphonic acid |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1P(=O)(O)O |
| InChI | InChI=1S/C15H13N2O5P/c18-13-15(11-7-3-1-4-8-11,12-9-5-2-6-10-12)16-14(19)17(13)23(20,21)22/h1-10H,(H,16,19)(H2,20,21,22) |
| InChIKey | UIZGYHLEISMAAZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|