C28H36F2N4O5S — CID 58623267
1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-(oxan-2-yloxy)piperidine-4-carboxamide (PubChem CID 58623267) has the molecular formula C28H36F2N4O5S and a molecular weight of 578.68 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-(oxan-2-yloxy)piperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-(oxan-2-yloxy)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623267 |
| Molecular Formula | C28H36F2N4O5S |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-(oxan-2-yloxy)piperidine-4-carboxamide |
| SMILES | CC(F)(F)CCc1cnc(-c2ccc(S(=O)(=O)C3(C(=O)NOC4CCCCO4)CCN(C4CC4)CC3)cc2)cn1 |
| InChI | InChI=1S/C28H36F2N4O5S/c1-27(29,30)12-11-21-18-32-24(19-31-21)20-5-9-23(10-6-20)40(36,37)28(13-15-34(16-14-28)22-7-8-22)26(35)33-39-25-4-2-3-17-38-25/h5-6,9-10,18-19,22,25H,2-4,7-8,11-17H2,1H3,(H,33,35) |
| InChIKey | SPBLCMLJBAJJQR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|