C20H34BrCl2NSiZr — CID 58675326
(4-bromo-2,6-dimethylphenyl)-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+) (PubChem CID 58675326) has the molecular formula C20H34BrCl2NSiZr and a molecular weight of 558.62 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl)-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+).
| Compound Name | (4-bromo-2,6-dimethylphenyl)-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 58675326 |
| Molecular Formula | C20H34BrCl2NSiZr |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl)-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorozirconium(2+) |
| SMILES | Cc1cc(Br)cc(C)c1[N-][Si](C)(C)C1C(C)C(C)C(C)C1C.Cl[Zr+2]Cl.[CH3-] |
| InChI | InChI=1S/C19H31BrNSi.CH3.2ClH.Zr/c1-11-9-17(20)10-12(2)18(11)21-22(7,8)19-15(5)13(3)14(4)16(19)6;;;;/h9-10,13-16,19H,1-8H3;1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | PKEMPJLHLGJYSV-UHFFFAOYSA-L |
| XLogP | 9.03 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|