C14H15S+ — CID 58683131
10-methyl-9,9a-dihydro-4aH-thioxanthen-10-ium (PubChem CID 58683131) has the molecular formula C14H15S+ and a molecular weight of 215.34 g/mol. Its IUPAC name is 10-methyl-9,9a-dihydro-4aH-thioxanthen-10-ium.
| Compound Name | 10-methyl-9,9a-dihydro-4aH-thioxanthen-10-ium |
|---|---|
| PubChem CID | 58683131 |
| Molecular Formula | C14H15S+ |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 10-methyl-9,9a-dihydro-4aH-thioxanthen-10-ium |
| SMILES | C[S+]1c2ccccc2CC2C=CC=CC21 |
| InChI | InChI=1S/C14H15S/c1-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-9,11,13H,10H2,1H3/q+1 |
| InChIKey | GKTLBYDBTPWSFD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|