C18H18N2O2 — CID 58747212
(Z)-3-[4-(diethylamino)naphthalen-1-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 58747212) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (Z)-3-[4-(diethylamino)naphthalen-1-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[4-(diethylamino)naphthalen-1-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58747212 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (Z)-3-[4-(diethylamino)naphthalen-1-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(N(CC)CC)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H18N2O2/c1-4-20(5-2)17-11-10-13(12-16(19-3)18(21)22)14-8-6-7-9-15(14)17/h6-12H,4-5H2,1-2H3,(H,21,22)/b16-12- |
| InChIKey | JNFCTMLTPZRYTH-VBKFSLOCSA-N |
| XLogP | 4.03 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|