C45H78N2 — CID 58798877
N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]nonane-1,9-diamine (PubChem CID 58798877) has the molecular formula C45H78N2 and a molecular weight of 647.13 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]nonane-1,9-diamine.
| Compound Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]nonane-1,9-diamine |
|---|---|
| PubChem CID | 58798877 |
| Molecular Formula | C45H78N2 |
| Molecular Weight | 647.13 g/mol |
| Exact Mass | 646.62 |
| IUPAC Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]nonane-1,9-diamine |
| SMILES | C[C@H]1[C@H](C)[C@@H](N(CCCCCCCCCN([C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)C=C[C@H]1C |
| InChI | InChI=1S/C45H78N2/c1-30-20-24-42(38(9)34(30)5)46(43-25-21-31(2)35(6)39(43)10)28-18-16-14-13-15-17-19-29-47(44-26-22-32(3)36(7)40(44)11)45-27-23-33(4)37(8)41(45)12/h20-27,30-45H,13-19,28-29H2,1-12H3/t30-,31-,32-,33-,34-,35-,36-,37-,38+,39+,40+,41+,42+,43+,44+,45+/m1/s1 |
| InChIKey | ARZMGVBAQYUHAY-IZSXCJKYSA-N |
| XLogP | 11.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.13 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|