C38H64N2 — CID 58798909
N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]ethane-1,2-diamine (PubChem CID 58798909) has the molecular formula C38H64N2 and a molecular weight of 548.94 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58798909 |
| Molecular Formula | C38H64N2 |
| Molecular Weight | 548.94 g/mol |
| Exact Mass | 548.51 |
| IUPAC Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]ethane-1,2-diamine |
| SMILES | CC1[C@H](C)C=C[C@H](N(CCN([C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C38H64N2/c1-23-13-17-35(31(9)27(23)5)39(36-18-14-24(2)28(6)32(36)10)21-22-40(37-19-15-25(3)29(7)33(37)11)38-20-16-26(4)30(8)34(38)12/h13-20,23-38H,21-22H2,1-12H3/t23-,24-,25-,26-,27-,28-,29-,30?,31+,32+,33+,34+,35+,36+,37+,38+/m1/s1 |
| InChIKey | DQDRQMFDXDUOOH-IHZORZHOSA-N |
| XLogP | 8.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.94 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|