C44H54N2O3S — CID 58800173
(2E)-2-[(E)-3-[3-(7,7-dimethyloctyl)-1,1-dimethyl-7-oxidoperoxysulfanylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,1,7-trimethylbenzo[e]indole (PubChem CID 58800173) has the molecular formula C44H54N2O3S and a molecular weight of 690.99 g/mol. Its IUPAC name is (2E)-2-[(E)-3-[3-(7,7-dimethyloctyl)-1,1-dimethyl-7-oxidoperoxysulfanylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,1,7-trimethylbenzo[e]indole.
| Compound Name | (2E)-2-[(E)-3-[3-(7,7-dimethyloctyl)-1,1-dimethyl-7-oxidoperoxysulfanylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,1,7-trimethylbenzo[e]indole |
|---|---|
| PubChem CID | 58800173 |
| Molecular Formula | C44H54N2O3S |
| Molecular Weight | 690.99 g/mol |
| Exact Mass | 690.39 |
| IUPAC Name | (2E)-2-[(E)-3-[3-(7,7-dimethyloctyl)-1,1-dimethyl-7-oxidoperoxysulfanylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,1,7-trimethylbenzo[e]indole |
| SMILES | CCN1/C(=C/C=C/C2=[N+](CCCCCCC(C)(C)C)c3ccc4cc(SOO[O-])ccc4c3C2(C)C)C(C)(C)c2c1ccc1cc(C)ccc21 |
| InChI | InChI=1S/C44H54N2O3S/c1-10-45-36-24-19-31-28-30(2)18-22-34(31)40(36)43(6,7)38(45)16-15-17-39-44(8,9)41-35-23-21-33(50-49-48-47)29-32(35)20-25-37(41)46(39)27-14-12-11-13-26-42(3,4)5/h15-25,28-29H,10-14,26-27H2,1-9H3 |
| InChIKey | HCHBGOLEVGWQDS-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.99 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|