C31H66O3Si2 — CID 58822516
tert-butyl-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethylundec-7-enoxy]-dimethylsilane (PubChem CID 58822516) has the molecular formula C31H66O3Si2 and a molecular weight of 543.04 g/mol. Its IUPAC name is tert-butyl-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethylundec-7-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethylundec-7-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58822516 |
| Molecular Formula | C31H66O3Si2 |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.46 |
| IUPAC Name | tert-butyl-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethylundec-7-enoxy]-dimethylsilane |
| SMILES | CCC/C=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)OC |
| InChI | InChI=1S/C31H66O3Si2/c1-18-19-20-21-23(2)28(33-35(14,15)30(7,8)9)24(3)22-25(4)29(26(5)27(6)32-13)34-36(16,17)31(10,11)12/h20-21,23-29H,18-19,22H2,1-17H3/b21-20- |
| InChIKey | CTAFTNADCHILEB-MRCUWXFGSA-N |
| XLogP | 10.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|