C36H54O3Si — CID 58825241
(2R,3S,3aR,3bR,6aS,7aS)-2-[(3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutyl]-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-7a-ol (PubChem CID 58825241) has the molecular formula C36H54O3Si and a molecular weight of 562.91 g/mol. Its IUPAC name is (2R,3S,3aR,3bR,6aS,7aS)-2-[(3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutyl]-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-7a-ol.
| Compound Name | (2R,3S,3aR,3bR,6aS,7aS)-2-[(3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutyl]-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-7a-ol |
|---|---|
| PubChem CID | 58825241 |
| Molecular Formula | C36H54O3Si |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | (2R,3S,3aR,3bR,6aS,7aS)-2-[(3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutyl]-3,3b,4,6,6a-pentamethyl-3,3a,4,5,6,7-hexahydro-2H-pentaleno[2,1-b]furan-7a-ol |
| SMILES | CC1CC(C)[C@]2(C)[C@H]3[C@H](C)[C@@H](CC[C@@H](C)CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)O[C@@]3(O)C[C@@]12C |
| InChI | InChI=1S/C36H54O3Si/c1-25(23-38-40(33(5,6)7,29-16-12-10-13-17-29)30-18-14-11-15-19-30)20-21-31-28(4)32-35(9)27(3)22-26(2)34(35,8)24-36(32,37)39-31/h10-19,25-28,31-32,37H,20-24H2,1-9H3/t25-,26?,27?,28-,31-,32-,34+,35-,36+/m1/s1 |
| InChIKey | JXPZDZQGBGJVEW-DIDGQPGXSA-N |
| XLogP | 7.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|