C34H48N8O4S — CID 58865850
N-[4-[[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]sulfamoyl]phenyl]-2-ethylheptanamide (PubChem CID 58865850) has the molecular formula C34H48N8O4S and a molecular weight of 664.88 g/mol. Its IUPAC name is N-[4-[[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]sulfamoyl]phenyl]-2-ethylheptanamide.
| Compound Name | N-[4-[[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]sulfamoyl]phenyl]-2-ethylheptanamide |
|---|---|
| PubChem CID | 58865850 |
| Molecular Formula | C34H48N8O4S |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | N-[4-[[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]sulfamoyl]phenyl]-2-ethylheptanamide |
| SMILES | CCCCCC(CC)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Nc3nc(N4CCCCC4)nc(N4CCCCC4)n3)cc2O)cc1 |
| InChI | InChI=1S/C34H48N8O4S/c1-3-5-8-13-25(4-2)31(44)35-26-14-17-28(18-15-26)47(45,46)40-29-19-16-27(24-30(29)43)36-32-37-33(41-20-9-6-10-21-41)39-34(38-32)42-22-11-7-12-23-42/h14-19,24-25,40,43H,3-13,20-23H2,1-2H3,(H,35,44)(H,36,37,38,39) |
| InChIKey | JWFXDDUEHGEKMN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|