C30H46ClN13O3S — CID 159194858
N-[4-[[2-amino-4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]sulfamoyl]phenyl]pentanamide;hydrochloride (PubChem CID 159194858) has the molecular formula C30H46ClN13O3S and a molecular weight of 704.31 g/mol. Its IUPAC name is N-[4-[[2-amino-4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]sulfamoyl]phenyl]pentanamide;hydrochloride.
| Compound Name | N-[4-[[2-amino-4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]sulfamoyl]phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 159194858 |
| Molecular Formula | C30H46ClN13O3S |
| Molecular Weight | 704.31 g/mol |
| Exact Mass | 703.33 |
| IUPAC Name | N-[4-[[2-amino-4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]sulfamoyl]phenyl]pentanamide;hydrochloride |
| SMILES | CCCCC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Nc3nc(N4C[C@H](N)C[C@H](N)C4)nc(N4C[C@H](N)C[C@H](N)C4)n3)cc2N)cc1.Cl |
| InChI | InChI=1S/C30H45N13O3S.ClH/c1-2-3-4-27(44)36-22-5-8-24(9-6-22)47(45,46)41-26-10-7-23(13-25(26)35)37-28-38-29(42-14-18(31)11-19(32)15-42)40-30(39-28)43-16-20(33)12-21(34)17-43;/h5-10,13,18-21,41H,2-4,11-12,14-17,31-35H2,1H3,(H,36,44)(H,37,38,39,40);1H/t18-,19+,20-,21+; |
| InChIKey | BNBHZQUOFMJGEO-FZPKMPHISA-N |
| XLogP | 1.28 |
| TPSA | 262.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|