C51H38N4O6 — CID 58937619
[4-[N-[4-[2-[4-[methyl-(4-prop-2-enoyloxynaphthalen-1-yl)amino]phenyl]ethenyl]phenyl]-4-[(4-nitrophenyl)methyl]anilino]phenyl] 2-cyanoprop-2-enoate (PubChem CID 58937619) has the molecular formula C51H38N4O6 and a molecular weight of 802.89 g/mol. Its IUPAC name is [4-[N-[4-[2-[4-[methyl-(4-prop-2-enoyloxynaphthalen-1-yl)amino]phenyl]ethenyl]phenyl]-4-[(4-nitrophenyl)methyl]anilino]phenyl] 2-cyanoprop-2-enoate.
| Compound Name | [4-[N-[4-[2-[4-[methyl-(4-prop-2-enoyloxynaphthalen-1-yl)amino]phenyl]ethenyl]phenyl]-4-[(4-nitrophenyl)methyl]anilino]phenyl] 2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 58937619 |
| Molecular Formula | C51H38N4O6 |
| Molecular Weight | 802.89 g/mol |
| Exact Mass | 802.28 |
| IUPAC Name | [4-[N-[4-[2-[4-[methyl-(4-prop-2-enoyloxynaphthalen-1-yl)amino]phenyl]ethenyl]phenyl]-4-[(4-nitrophenyl)methyl]anilino]phenyl] 2-cyanoprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(C)c2ccc(C=Cc3ccc(N(c4ccc(Cc5ccc([N+](=O)[O-])cc5)cc4)c4ccc(OC(=O)C(=C)C#N)cc4)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C51H38N4O6/c1-4-50(56)61-49-32-31-48(46-7-5-6-8-47(46)49)53(3)40-19-11-36(12-20-40)9-10-37-13-21-41(22-14-37)54(43-27-29-45(30-28-43)60-51(57)35(2)34-52)42-23-15-38(16-24-42)33-39-17-25-44(26-18-39)55(58)59/h4-32H,1-2,33H2,3H3 |
| InChIKey | OFSPCKRDXWNHHM-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 126.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.89 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|